C8H6BrClF2O — CID 143865225
1-(3-bromophenyl)-2-chloro-2,2-difluoroethanol (PubChem CID 143865225) has the molecular formula C8H6BrClF2O and a molecular weight of 271.49 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-chloro-2,2-difluoroethanol.
| Compound Name | 1-(3-bromophenyl)-2-chloro-2,2-difluoroethanol |
|---|---|
| PubChem CID | 143865225 |
| Molecular Formula | C8H6BrClF2O |
| Molecular Weight | 271.49 g/mol |
| Exact Mass | 269.93 |
| IUPAC Name | 1-(3-bromophenyl)-2-chloro-2,2-difluoroethanol |
| SMILES | OC(c1cccc(Br)c1)C(F)(F)Cl |
| InChI | InChI=1S/C8H6BrClF2O/c9-6-3-1-2-5(4-6)7(13)8(10,11)12/h1-4,7,13H |
| InChIKey | SWWFONPWVVBFRK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|