C12H12BrF3O3 — CID 158949702
(5S,6S)-6-(3-bromophenyl)-1,1,1-trifluoro-5,6-dihydroxyhexan-2-one (PubChem CID 158949702) has the molecular formula C12H12BrF3O3 and a molecular weight of 341.12 g/mol. Its IUPAC name is (5S,6S)-6-(3-bromophenyl)-1,1,1-trifluoro-5,6-dihydroxyhexan-2-one.
| Compound Name | (5S,6S)-6-(3-bromophenyl)-1,1,1-trifluoro-5,6-dihydroxyhexan-2-one |
|---|---|
| PubChem CID | 158949702 |
| Molecular Formula | C12H12BrF3O3 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | (5S,6S)-6-(3-bromophenyl)-1,1,1-trifluoro-5,6-dihydroxyhexan-2-one |
| SMILES | O=C(CC[C@H](O)[C@@H](O)c1cccc(Br)c1)C(F)(F)F |
| InChI | InChI=1S/C12H12BrF3O3/c13-8-3-1-2-7(6-8)11(19)9(17)4-5-10(18)12(14,15)16/h1-3,6,9,11,17,19H,4-5H2/t9-,11-/m0/s1 |
| InChIKey | OJYCWAORKNIVIQ-ONGXEEELSA-N |
| XLogP | 2.76 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |