C11H12ClF3O3 — CID 171894388
4-chloro-1-[3-(trifluoromethoxy)phenyl]butane-1,2-diol (PubChem CID 171894388) has the molecular formula C11H12ClF3O3 and a molecular weight of 284.66 g/mol. Its IUPAC name is 4-chloro-1-[3-(trifluoromethoxy)phenyl]butane-1,2-diol.
| Compound Name | 4-chloro-1-[3-(trifluoromethoxy)phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 171894388 |
| Molecular Formula | C11H12ClF3O3 |
| Molecular Weight | 284.66 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 4-chloro-1-[3-(trifluoromethoxy)phenyl]butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C11H12ClF3O3/c12-5-4-9(16)10(17)7-2-1-3-8(6-7)18-11(13,14)15/h1-3,6,9-10,16-17H,4-5H2 |
| InChIKey | ANPBCERXNQGODD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.66 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|