C12H12ClF3O4 — CID 171894742
3-(4-chloro-1,2-dihydroxybutyl)-5-(trifluoromethoxy)benzaldehyde (PubChem CID 171894742) has the molecular formula C12H12ClF3O4 and a molecular weight of 312.67 g/mol. Its IUPAC name is 3-(4-chloro-1,2-dihydroxybutyl)-5-(trifluoromethoxy)benzaldehyde.
| Compound Name | 3-(4-chloro-1,2-dihydroxybutyl)-5-(trifluoromethoxy)benzaldehyde |
|---|---|
| PubChem CID | 171894742 |
| Molecular Formula | C12H12ClF3O4 |
| Molecular Weight | 312.67 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-(4-chloro-1,2-dihydroxybutyl)-5-(trifluoromethoxy)benzaldehyde |
| SMILES | O=Cc1cc(OC(F)(F)F)cc(C(O)C(O)CCCl)c1 |
| InChI | InChI=1S/C12H12ClF3O4/c13-2-1-10(18)11(19)8-3-7(6-17)4-9(5-8)20-12(14,15)16/h3-6,10-11,18-19H,1-2H2 |
| InChIKey | SORSYTWQPQJTHA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.67 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|