C10H11ClF2O2 — CID 171893381
4-chloro-1-(3,5-difluorophenyl)butane-1,2-diol (PubChem CID 171893381) has the molecular formula C10H11ClF2O2 and a molecular weight of 236.64 g/mol. Its IUPAC name is 4-chloro-1-(3,5-difluorophenyl)butane-1,2-diol.
| Compound Name | 4-chloro-1-(3,5-difluorophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171893381 |
| Molecular Formula | C10H11ClF2O2 |
| Molecular Weight | 236.64 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 4-chloro-1-(3,5-difluorophenyl)butane-1,2-diol |
| SMILES | OC(CCCl)C(O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C10H11ClF2O2/c11-2-1-9(14)10(15)6-3-7(12)5-8(13)4-6/h3-5,9-10,14-15H,1-2H2 |
| InChIKey | JMJKTJKQKGUIJP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|