C9H13ClO3S — CID 171893230
4-chloro-1-[5-(hydroxymethyl)thiophen-3-yl]butane-1,2-diol (PubChem CID 171893230) has the molecular formula C9H13ClO3S and a molecular weight of 236.72 g/mol. Its IUPAC name is 4-chloro-1-[5-(hydroxymethyl)thiophen-3-yl]butane-1,2-diol.
| Compound Name | 4-chloro-1-[5-(hydroxymethyl)thiophen-3-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 171893230 |
| Molecular Formula | C9H13ClO3S |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 4-chloro-1-[5-(hydroxymethyl)thiophen-3-yl]butane-1,2-diol |
| SMILES | OCc1cc(C(O)C(O)CCCl)cs1 |
| InChI | InChI=1S/C9H13ClO3S/c10-2-1-8(12)9(13)6-3-7(4-11)14-5-6/h3,5,8-9,11-13H,1-2,4H2 |
| InChIKey | JZQQVJZRODLUIN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|