C9H12N2O2S — CID 171880737
4-(4-amino-1,2-dihydroxybutyl)thiophene-2-carbonitrile (PubChem CID 171880737) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 4-(4-amino-1,2-dihydroxybutyl)thiophene-2-carbonitrile.
| Compound Name | 4-(4-amino-1,2-dihydroxybutyl)thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 171880737 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4-(4-amino-1,2-dihydroxybutyl)thiophene-2-carbonitrile |
| SMILES | N#Cc1cc(C(O)C(O)CCN)cs1 |
| InChI | InChI=1S/C9H12N2O2S/c10-2-1-8(12)9(13)6-3-7(4-11)14-5-6/h3,5,8-9,12-13H,1-2,10H2 |
| InChIKey | HRUMRGAOALAAIS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |