About 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile
4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile (PubChem CID 55293892) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile |
| PubChem CID | 55293892 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile |
| SMILES | C[C@H](O)[C@@H](N)c1csc(C#N)c1 |
| InChI | InChI=1S/C8H10N2OS/c1-5(11)8(10)6-2-7(3-9)12-4-6/h2,4-5,8,11H,10H2,1H3/t5-,8+/m0/s1 |
| InChIKey | WKLFORZHAJIEIR-YLWLKBPMSA-N |
| XLogP | 1.00 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile?
The IUPAC name of 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile (CID 55293892) is 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile.
What is the SMILES notation for 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile?
The canonical SMILES for 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile is C[C@H](O)[C@@H](N)c1csc(C#N)c1.
What is the InChIKey of 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile?
The InChIKey is WKLFORZHAJIEIR-YLWLKBPMSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-5(11)8(10)6-2-7(3-9)12-4-6/h2,4-5,8,11H,10H2,1H3/t5-,8+/m0/s1.
What are the key properties of 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile?
4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile has a molecular weight of 182.25 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,2S)-1-amino-2-hydroxypropyl]thiophene-2-carbonitrile is sourced from PubChem (CID 55293892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).