C12H15NO2S — CID 171881402
4-amino-1-(1-benzothiophen-6-yl)butane-1,2-diol (PubChem CID 171881402) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is 4-amino-1-(1-benzothiophen-6-yl)butane-1,2-diol.
| Compound Name | 4-amino-1-(1-benzothiophen-6-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171881402 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 4-amino-1-(1-benzothiophen-6-yl)butane-1,2-diol |
| SMILES | NCCC(O)C(O)c1ccc2ccsc2c1 |
| InChI | InChI=1S/C12H15NO2S/c13-5-3-10(14)12(15)9-2-1-8-4-6-16-11(8)7-9/h1-2,4,6-7,10,12,14-15H,3,5,13H2 |
| InChIKey | HILSZFLIHJOJES-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |