C11H12O3S — CID 170817998
1-(1-benzothiophen-6-yl)propane-1,2,3-triol (PubChem CID 170817998) has the molecular formula C11H12O3S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(1-benzothiophen-6-yl)propane-1,2,3-triol.
| Compound Name | 1-(1-benzothiophen-6-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817998 |
| Molecular Formula | C11H12O3S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1-(1-benzothiophen-6-yl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)c1ccc2ccsc2c1 |
| InChI | InChI=1S/C11H12O3S/c12-6-9(13)11(14)8-2-1-7-3-4-15-10(7)5-8/h1-5,9,11-14H,6H2 |
| InChIKey | YMCQIXDGMNEVEE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |