C11H12O2S2 — CID 170820018
1-(1-benzothiophen-5-yl)-3-sulfanylpropane-1,2-diol (PubChem CID 170820018) has the molecular formula C11H12O2S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(1-benzothiophen-5-yl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(1-benzothiophen-5-yl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820018 |
| Molecular Formula | C11H12O2S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 1-(1-benzothiophen-5-yl)-3-sulfanylpropane-1,2-diol |
| SMILES | OC(CS)C(O)c1ccc2sccc2c1 |
| InChI | InChI=1S/C11H12O2S2/c12-9(6-14)11(13)8-1-2-10-7(5-8)3-4-15-10/h1-5,9,11-14H,6H2 |
| InChIKey | SATKMBQGCLLZPL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|