C9H11BrO2S — CID 170820927
1-(4-bromophenyl)-3-sulfanylpropane-1,2-diol (PubChem CID 170820927) has the molecular formula C9H11BrO2S and a molecular weight of 263.16 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-sulfanylpropane-1,2-diol.
| Compound Name | 1-(4-bromophenyl)-3-sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 170820927 |
| Molecular Formula | C9H11BrO2S |
| Molecular Weight | 263.16 g/mol |
| Exact Mass | 261.97 |
| IUPAC Name | 1-(4-bromophenyl)-3-sulfanylpropane-1,2-diol |
| SMILES | OC(CS)C(O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C9H11BrO2S/c10-7-3-1-6(2-4-7)9(12)8(11)5-13/h1-4,8-9,11-13H,5H2 |
| InChIKey | SPPWCBJVKPWRDD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.16 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|