C14H12Br2O2 — CID 11046931
(1R,2R)-1,2-bis(4-bromophenyl)ethane-1,2-diol (PubChem CID 11046931) has the molecular formula C14H12Br2O2 and a molecular weight of 372.06 g/mol. Its IUPAC name is (1R,2R)-1,2-bis(4-bromophenyl)ethane-1,2-diol.
| Compound Name | (1R,2R)-1,2-bis(4-bromophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 11046931 |
| Molecular Formula | C14H12Br2O2 |
| Molecular Weight | 372.06 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | (1R,2R)-1,2-bis(4-bromophenyl)ethane-1,2-diol |
| SMILES | O[C@H](c1ccc(Br)cc1)[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H12Br2O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8,13-14,17-18H/t13-,14-/m1/s1 |
| InChIKey | GVQCDJVKPDOTCB-ZIAGYGMSSA-N |
| XLogP | 3.98 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.06 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |