C14H11BrF2O — CID 15942068
(1R)-1-[4-(4-bromophenyl)phenyl]-2,2-difluoroethanol (PubChem CID 15942068) has the molecular formula C14H11BrF2O and a molecular weight of 313.14 g/mol. Its IUPAC name is (1R)-1-[4-(4-bromophenyl)phenyl]-2,2-difluoroethanol.
| Compound Name | (1R)-1-[4-(4-bromophenyl)phenyl]-2,2-difluoroethanol |
|---|---|
| PubChem CID | 15942068 |
| Molecular Formula | C14H11BrF2O |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | (1R)-1-[4-(4-bromophenyl)phenyl]-2,2-difluoroethanol |
| SMILES | O[C@H](c1ccc(-c2ccc(Br)cc2)cc1)C(F)F |
| InChI | InChI=1S/C14H11BrF2O/c15-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(18)14(16)17/h1-8,13-14,18H/t13-/m1/s1 |
| InChIKey | LPNHUIALEZHGGH-CYBMUJFWSA-N |
| XLogP | 4.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |