About CID 156792861
CID 156792861 (PubChem CID 156792861) has the molecular formula C7H5BBrF
and a molecular weight of 198.83 g/mol.
Molecular Properties
| Compound Name | CID 156792861 |
| PubChem CID | 156792861 |
| Molecular Formula | C7H5BBrF |
| Molecular Weight | 198.83 g/mol |
| Exact Mass | 197.97 |
| IUPAC Name | — |
| SMILES | [B]C(F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C7H5BBrF/c8-7(10)5-1-3-6(9)4-2-5/h1-4,7H |
| InChIKey | CQNXRBGUIKIQMJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.83 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156792861 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156792861?
The IUPAC name of CID 156792861 (CID 156792861) is not available.
What is the SMILES notation for CID 156792861?
The canonical SMILES for CID 156792861 is [B]C(F)c1ccc(Br)cc1.
What is the InChIKey of CID 156792861?
The InChIKey is CQNXRBGUIKIQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BBrF/c8-7(10)5-1-3-6(9)4-2-5/h1-4,7H.
What are the key properties of CID 156792861?
CID 156792861 has a molecular weight of 198.83 g/mol, XLogP of 2.59, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156792861 is sourced from PubChem (CID 156792861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).