C13H7BrF5N — CID 43607952
(4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanamine (PubChem CID 43607952) has the molecular formula C13H7BrF5N and a molecular weight of 352.10 g/mol. Its IUPAC name is (4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanamine.
| Compound Name | (4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanamine |
|---|---|
| PubChem CID | 43607952 |
| Molecular Formula | C13H7BrF5N |
| Molecular Weight | 352.10 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | (4-bromophenyl)-(2,3,4,5,6-pentafluorophenyl)methanamine |
| SMILES | NC(c1ccc(Br)cc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H7BrF5N/c14-6-3-1-5(2-4-6)13(20)7-8(15)10(17)12(19)11(18)9(7)16/h1-4,13H,20H2 |
| InChIKey | DAUDTTUQKUKMOH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.10 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|