C13H9BrF3N — CID 106942181
(3-bromo-2,6-difluorophenyl)-(4-fluorophenyl)methanamine (PubChem CID 106942181) has the molecular formula C13H9BrF3N and a molecular weight of 316.12 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(4-fluorophenyl)methanamine.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(4-fluorophenyl)methanamine |
|---|---|
| PubChem CID | 106942181 |
| Molecular Formula | C13H9BrF3N |
| Molecular Weight | 316.12 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(4-fluorophenyl)methanamine |
| SMILES | NC(c1ccc(F)cc1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H9BrF3N/c14-9-5-6-10(16)11(12(9)17)13(18)7-1-3-8(15)4-2-7/h1-6,13H,18H2 |
| InChIKey | LPRDHQAKDAWSPC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.12 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|