C11H7BrClF2NS — CID 106944889
(3-bromo-2,6-difluorophenyl)-(5-chlorothiophen-2-yl)methanamine (PubChem CID 106944889) has the molecular formula C11H7BrClF2NS and a molecular weight of 338.60 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(5-chlorothiophen-2-yl)methanamine.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(5-chlorothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 106944889 |
| Molecular Formula | C11H7BrClF2NS |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(5-chlorothiophen-2-yl)methanamine |
| SMILES | NC(c1ccc(Cl)s1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H7BrClF2NS/c12-5-1-2-6(14)9(10(5)15)11(16)7-3-4-8(13)17-7/h1-4,11H,16H2 |
| InChIKey | DKYNURXGTTZAEH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|