C13H9BrF2O — CID 61100872
(4-bromophenyl)-(2,6-difluorophenyl)methanol (PubChem CID 61100872) has the molecular formula C13H9BrF2O and a molecular weight of 299.11 g/mol. Its IUPAC name is (4-bromophenyl)-(2,6-difluorophenyl)methanol.
| Compound Name | (4-bromophenyl)-(2,6-difluorophenyl)methanol |
|---|---|
| PubChem CID | 61100872 |
| Molecular Formula | C13H9BrF2O |
| Molecular Weight | 299.11 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | (4-bromophenyl)-(2,6-difluorophenyl)methanol |
| SMILES | OC(c1ccc(Br)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C13H9BrF2O/c14-9-6-4-8(5-7-9)13(17)12-10(15)2-1-3-11(12)16/h1-7,13,17H |
| InChIKey | SWKAWCXPBAVRRI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.11 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |