(2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol

C13H11F2NO — CID 63893537

IUPAC(2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol
SMILESCc1ccc(C(O)c2c(F)cccc2F)cn1
InChIInChI=1S/C13H11F2NO/c1-8-5-6-9(7-16-8)13(17)12-10(14)3-2-4-11(12)15/h2-7,13,17H,1H3
InChIKeyHJJBQGWHQNHDOM-UHFFFAOYSA-N
MW235.23 g/mol
LogP2.75
Rot. Bonds2

About (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol

(2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol (PubChem CID 63893537) has the molecular formula C13H11F2NO and a molecular weight of 235.23 g/mol. Its IUPAC name is (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol.

Molecular Properties

Compound Name(2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol
PubChem CID63893537
Molecular FormulaC13H11F2NO
Molecular Weight235.23 g/mol
Exact Mass235.08
IUPAC Name(2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol
SMILESCc1ccc(C(O)c2c(F)cccc2F)cn1
InChIInChI=1S/C13H11F2NO/c1-8-5-6-9(7-16-8)13(17)12-10(14)3-2-4-11(12)15/h2-7,13,17H,1H3
InChIKeyHJJBQGWHQNHDOM-UHFFFAOYSA-N
XLogP2.75
TPSA33.12 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500235.23
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2,6-difluorophenyl)-(4-methylphenyl)methanol
CID 61101417
(S)-(6-methyl-3-pyridinyl)-phenylmethanol
CID 122230267
(6-methyl-3-pyridinyl)-(4-phenylphenyl)methanol
CID 63895075
(6-methyl-3-pyridinyl)-(2-methylsulfanylphenyl)methanol
CID 115796738
(4-bromophenyl)-(2,6-difluorophenyl)methanol
CID 61100872
(6-methyl-3-pyridinyl)-pyridazin-4-ylmethanol
CID 105096831
(2-bromo-4-fluorophenyl)-(6-methyl-3-pyridinyl)methanol
CID 115796740
(4-methoxyphenyl)-(6-methyl-3-pyridinyl)methanol
CID 63155903
(2-methyl-4-pyridinyl)-(6-methyl-3-pyridinyl)methanol
CID 106756194
(2,6-difluoro-3-methylphenyl)-(6-methoxy-3-pyridinyl)methanol
CID 114937941
(6-methyl-3-pyridinyl)-[4-(trifluoromethylsulfanyl)phenyl]methanol
CID 63895500
(6-methyl-3-pyridinyl)-thiophen-3-ylmethanol
CID 63155454

Frequently Asked Questions

What is the IUPAC name of (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol?
The IUPAC name of (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol (CID 63893537) is (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol.
What is the SMILES notation for (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol?
The canonical SMILES for (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol is Cc1ccc(C(O)c2c(F)cccc2F)cn1.
What is the InChIKey of (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol?
The InChIKey is HJJBQGWHQNHDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F2NO/c1-8-5-6-9(7-16-8)13(17)12-10(14)3-2-4-11(12)15/h2-7,13,17H,1H3.
What are the key properties of (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol?
(2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol has a molecular weight of 235.23 g/mol, XLogP of 2.75, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl)-(6-methyl-3-pyridinyl)methanol is sourced from PubChem (CID 63893537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).