C11H13BrO2 — CID 129404262
(3R,4S)-4-(4-bromophenyl)-4-hydroxy-3-methylbutan-2-one (PubChem CID 129404262) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is (3R,4S)-4-(4-bromophenyl)-4-hydroxy-3-methylbutan-2-one.
| Compound Name | (3R,4S)-4-(4-bromophenyl)-4-hydroxy-3-methylbutan-2-one |
|---|---|
| PubChem CID | 129404262 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | (3R,4S)-4-(4-bromophenyl)-4-hydroxy-3-methylbutan-2-one |
| SMILES | CC(=O)[C@H](C)[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H13BrO2/c1-7(8(2)13)11(14)9-3-5-10(12)6-4-9/h3-7,11,14H,1-2H3/t7-,11-/m0/s1 |
| InChIKey | FSNZIXBQKYOTLP-CPCISQLKSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |