C12H16O3 — CID 129403910
(3R,4R)-4-hydroxy-4-(4-methoxyphenyl)-3-methylbutan-2-one (PubChem CID 129403910) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3R,4R)-4-hydroxy-4-(4-methoxyphenyl)-3-methylbutan-2-one.
| Compound Name | (3R,4R)-4-hydroxy-4-(4-methoxyphenyl)-3-methylbutan-2-one |
|---|---|
| PubChem CID | 129403910 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3R,4R)-4-hydroxy-4-(4-methoxyphenyl)-3-methylbutan-2-one |
| SMILES | COc1ccc([C@H](O)[C@@H](C)C(C)=O)cc1 |
| InChI | InChI=1S/C12H16O3/c1-8(9(2)13)12(14)10-4-6-11(15-3)7-5-10/h4-8,12,14H,1-3H3/t8-,12+/m0/s1 |
| InChIKey | KTQFTSACOFPESA-QPUJVOFHSA-N |
| XLogP | 1.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |