C11H11BrO2 — CID 14816158
3-(4-bromophenyl)pentane-2,4-dione (PubChem CID 14816158) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is 3-(4-bromophenyl)pentane-2,4-dione.
| Compound Name | 3-(4-bromophenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 14816158 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | 3-(4-bromophenyl)pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H11BrO2/c1-7(13)11(8(2)14)9-3-5-10(12)6-4-9/h3-6,11H,1-2H3 |
| InChIKey | KXLKREYVWSBIGN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|