C11H11BrO2 — CID 124638004
(E,5S)-5-(4-bromophenyl)-5-hydroxypent-3-en-2-one (PubChem CID 124638004) has the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. Its IUPAC name is (E,5S)-5-(4-bromophenyl)-5-hydroxypent-3-en-2-one.
| Compound Name | (E,5S)-5-(4-bromophenyl)-5-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 124638004 |
| Molecular Formula | C11H11BrO2 |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | (E,5S)-5-(4-bromophenyl)-5-hydroxypent-3-en-2-one |
| SMILES | CC(=O)/C=C/[C@H](O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H11BrO2/c1-8(13)2-7-11(14)9-3-5-10(12)6-4-9/h2-7,11,14H,1H3/b7-2+/t11-/m0/s1 |
| InChIKey | WOVJCEPCGPJDTK-FOKSMMDQSA-N |
| XLogP | 2.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|