(Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid

C10H9ClO3 — CID 6914274

IUPAC(Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid
SMILESO=C(O)/C=C\[C@H](O)c1ccc(Cl)cc1
InChIInChI=1S/C10H9ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-6,9,12H,(H,13,14)/b6-5-/t9-/m0/s1
InChIKeyFPLZDFIDWYDARU-UDIARPCQSA-N
MW212.63 g/mol
LogP2.01
Rot. Bonds3

About (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid

(Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid (PubChem CID 6914274) has the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. Its IUPAC name is (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid.

Molecular Properties

Compound Name(Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid
PubChem CID6914274
Molecular FormulaC10H9ClO3
Molecular Weight212.63 g/mol
Exact Mass212.02
IUPAC Name(Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid
SMILESO=C(O)/C=C\[C@H](O)c1ccc(Cl)cc1
InChIInChI=1S/C10H9ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-6,9,12H,(H,13,14)/b6-5-/t9-/m0/s1
InChIKeyFPLZDFIDWYDARU-UDIARPCQSA-N
XLogP2.01
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.63
LogP ≤ 52.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid?
The IUPAC name of (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid (CID 6914274) is (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid.
What is the SMILES notation for (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid?
The canonical SMILES for (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid is O=C(O)/C=C\[C@H](O)c1ccc(Cl)cc1.
What is the InChIKey of (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid?
The InChIKey is FPLZDFIDWYDARU-UDIARPCQSA-N. The full InChI is InChI=1S/C10H9ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-6,9,12H,(H,13,14)/b6-5-/t9-/m0/s1.
What are the key properties of (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid?
(Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid has a molecular weight of 212.63 g/mol, XLogP of 2.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,4S)-4-(4-chlorophenyl)-4-hydroxybut-2-enoic acid is sourced from PubChem (CID 6914274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).