C18H20Cl2O6 — CID 71336866
acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol (PubChem CID 71336866) has the molecular formula C18H20Cl2O6 and a molecular weight of 403.26 g/mol. Its IUPAC name is acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol.
| Compound Name | acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 71336866 |
| Molecular Formula | C18H20Cl2O6 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol |
| SMILES | CC(=O)O.CC(=O)O.OC(c1ccc(Cl)cc1)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2O2.2C2H4O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;2*1-2(3)4/h1-8,13-14,17-18H;2*1H3,(H,3,4) |
| InChIKey | OGGYBDVOOSEPPJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |