acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol

C18H20Cl2O6 — CID 71336866

IUPACacetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol
SMILESCC(=O)O.CC(=O)O.OC(c1ccc(Cl)cc1)C(O)c1ccc(Cl)cc1
InChIInChI=1S/C14H12Cl2O2.2C2H4O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;2*1-2(3)4/h1-8,13-14,17-18H;2*1H3,(H,3,4)
InChIKeyOGGYBDVOOSEPPJ-UHFFFAOYSA-N
MW403.26 g/mol
LogP3.94
Rot. Bonds3

About acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol

acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol (PubChem CID 71336866) has the molecular formula C18H20Cl2O6 and a molecular weight of 403.26 g/mol. Its IUPAC name is acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol.

Molecular Properties

Compound Nameacetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol
PubChem CID71336866
Molecular FormulaC18H20Cl2O6
Molecular Weight403.26 g/mol
Exact Mass402.06
IUPAC Nameacetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol
SMILESCC(=O)O.CC(=O)O.OC(c1ccc(Cl)cc1)C(O)c1ccc(Cl)cc1
InChIInChI=1S/C14H12Cl2O2.2C2H4O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;2*1-2(3)4/h1-8,13-14,17-18H;2*1H3,(H,3,4)
InChIKeyOGGYBDVOOSEPPJ-UHFFFAOYSA-N
XLogP3.94
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500403.26
LogP ≤ 53.94
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol?
The IUPAC name of acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol (CID 71336866) is acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol.
What is the SMILES notation for acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol?
The canonical SMILES for acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol is CC(=O)O.CC(=O)O.OC(c1ccc(Cl)cc1)C(O)c1ccc(Cl)cc1.
What is the InChIKey of acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol?
The InChIKey is OGGYBDVOOSEPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Cl2O2.2C2H4O2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10;2*1-2(3)4/h1-8,13-14,17-18H;2*1H3,(H,3,4).
What are the key properties of acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol?
acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol has a molecular weight of 403.26 g/mol, XLogP of 3.94, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1,2-bis(4-chlorophenyl)ethane-1,2-diol is sourced from PubChem (CID 71336866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).