C8H7Cl3O — CID 129405029
(1S)-2,2-dichloro-1-(4-chlorophenyl)ethanol (PubChem CID 129405029) has the molecular formula C8H7Cl3O and a molecular weight of 225.50 g/mol. Its IUPAC name is (1S)-2,2-dichloro-1-(4-chlorophenyl)ethanol.
| Compound Name | (1S)-2,2-dichloro-1-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 129405029 |
| Molecular Formula | C8H7Cl3O |
| Molecular Weight | 225.50 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | (1S)-2,2-dichloro-1-(4-chlorophenyl)ethanol |
| SMILES | O[C@@H](c1ccc(Cl)cc1)C(Cl)Cl |
| InChI | InChI=1S/C8H7Cl3O/c9-6-3-1-5(2-4-6)7(12)8(10)11/h1-4,7-8,12H/t7-/m0/s1 |
| InChIKey | NDRAYDLMSSAKPL-ZETCQYMHSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|