C11H15ClO2 — CID 103454768
1-(4-chlorophenyl)pentane-1,2-diol (PubChem CID 103454768) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 1-(4-chlorophenyl)pentane-1,2-diol.
| Compound Name | 1-(4-chlorophenyl)pentane-1,2-diol |
|---|---|
| PubChem CID | 103454768 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 1-(4-chlorophenyl)pentane-1,2-diol |
| SMILES | CCCC(O)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H15ClO2/c1-2-3-10(13)11(14)8-4-6-9(12)7-5-8/h4-7,10-11,13-14H,2-3H2,1H3 |
| InChIKey | BBUUYBOHETWEIZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |