C15H23ClO2 — CID 15778521
(1R,2S)-1-(4-chlorophenyl)nonane-1,2-diol (PubChem CID 15778521) has the molecular formula C15H23ClO2 and a molecular weight of 270.80 g/mol. Its IUPAC name is (1R,2S)-1-(4-chlorophenyl)nonane-1,2-diol.
| Compound Name | (1R,2S)-1-(4-chlorophenyl)nonane-1,2-diol |
|---|---|
| PubChem CID | 15778521 |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (1R,2S)-1-(4-chlorophenyl)nonane-1,2-diol |
| SMILES | CCCCCCC[C@H](O)[C@H](O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H23ClO2/c1-2-3-4-5-6-7-14(17)15(18)12-8-10-13(16)11-9-12/h8-11,14-15,17-18H,2-7H2,1H3/t14-,15+/m0/s1 |
| InChIKey | PIOYNEBNBHDMOJ-LSDHHAIUSA-N |
| XLogP | 4.09 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|