C16H26O2 — CID 15778520
(1R,2S)-1-(4-methylphenyl)nonane-1,2-diol (PubChem CID 15778520) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1R,2S)-1-(4-methylphenyl)nonane-1,2-diol.
| Compound Name | (1R,2S)-1-(4-methylphenyl)nonane-1,2-diol |
|---|---|
| PubChem CID | 15778520 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1R,2S)-1-(4-methylphenyl)nonane-1,2-diol |
| SMILES | CCCCCCC[C@H](O)[C@H](O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H26O2/c1-3-4-5-6-7-8-15(17)16(18)14-11-9-13(2)10-12-14/h9-12,15-18H,3-8H2,1-2H3/t15-,16+/m0/s1 |
| InChIKey | WPROQXANACAVML-JKSUJKDBSA-N |
| XLogP | 3.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|