C22H30OS2 — CID 13312351
1,1-bis[(4-methylphenyl)sulfanyl]octan-2-ol (PubChem CID 13312351) has the molecular formula C22H30OS2 and a molecular weight of 374.62 g/mol. Its IUPAC name is 1,1-bis[(4-methylphenyl)sulfanyl]octan-2-ol.
| Compound Name | 1,1-bis[(4-methylphenyl)sulfanyl]octan-2-ol |
|---|---|
| PubChem CID | 13312351 |
| Molecular Formula | C22H30OS2 |
| Molecular Weight | 374.62 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 1,1-bis[(4-methylphenyl)sulfanyl]octan-2-ol |
| SMILES | CCCCCCC(O)C(Sc1ccc(C)cc1)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C22H30OS2/c1-4-5-6-7-8-21(23)22(24-19-13-9-17(2)10-14-19)25-20-15-11-18(3)12-16-20/h9-16,21-23H,4-8H2,1-3H3 |
| InChIKey | UPPIZFCWJDONTE-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.62 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|