C18H30O3S — CID 102414482
(2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfinyldecane-2,4-diol (PubChem CID 102414482) has the molecular formula C18H30O3S and a molecular weight of 326.50 g/mol. Its IUPAC name is (2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfinyldecane-2,4-diol.
| Compound Name | (2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfinyldecane-2,4-diol |
|---|---|
| PubChem CID | 102414482 |
| Molecular Formula | C18H30O3S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (2R,3S,4R)-3-methyl-1-(4-methylphenyl)sulfinyldecane-2,4-diol |
| SMILES | CCCCCC[C@@H](O)[C@H](C)[C@@H](O)CS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H30O3S/c1-4-5-6-7-8-17(19)15(3)18(20)13-22(21)16-11-9-14(2)10-12-16/h9-12,15,17-20H,4-8,13H2,1-3H3/t15-,17+,18-,22?/m0/s1 |
| InChIKey | NADIMXQDGVEDEO-XIISLPFJSA-N |
| XLogP | 3.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|