C11H15BrO3S — CID 100945060
(2R,3S)-1-bromo-4-(4-methylphenyl)sulfinylbutane-2,3-diol (PubChem CID 100945060) has the molecular formula C11H15BrO3S and a molecular weight of 307.21 g/mol. Its IUPAC name is (2R,3S)-1-bromo-4-(4-methylphenyl)sulfinylbutane-2,3-diol.
| Compound Name | (2R,3S)-1-bromo-4-(4-methylphenyl)sulfinylbutane-2,3-diol |
|---|---|
| PubChem CID | 100945060 |
| Molecular Formula | C11H15BrO3S |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | (2R,3S)-1-bromo-4-(4-methylphenyl)sulfinylbutane-2,3-diol |
| SMILES | Cc1ccc(S(=O)C[C@@H](O)[C@@H](O)CBr)cc1 |
| InChI | InChI=1S/C11H15BrO3S/c1-8-2-4-9(5-3-8)16(15)7-11(14)10(13)6-12/h2-5,10-11,13-14H,6-7H2,1H3/t10-,11+,16?/m0/s1 |
| InChIKey | DMAJSCYSXWHMKG-BBXPGFNESA-N |
| XLogP | 1.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|