C10H11F3O2S — CID 102096195
(2R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylpropan-2-ol (PubChem CID 102096195) has the molecular formula C10H11F3O2S and a molecular weight of 252.26 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylpropan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylpropan-2-ol |
|---|---|
| PubChem CID | 102096195 |
| Molecular Formula | C10H11F3O2S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylpropan-2-ol |
| SMILES | Cc1ccc(S(=O)C[C@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H11F3O2S/c1-7-2-4-8(5-3-7)16(15)6-9(14)10(11,12)13/h2-5,9,14H,6H2,1H3/t9-,16?/m0/s1 |
| InChIKey | GLIYKUFNDONAPU-XUOZKRPMSA-N |
| XLogP | 2.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |