About 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene
1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene (PubChem CID 67811281) has the molecular formula C18H19F3O3S2
and a molecular weight of 404.48 g/mol. Its IUPAC name is 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene.
Molecular Properties
| Compound Name | 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene |
| PubChem CID | 67811281 |
| Molecular Formula | C18H19F3O3S2 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene |
| SMILES | Cc1ccc(S(=O)CC(CS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3O3S2/c1-13-3-7-16(8-4-13)25(22)11-15(18(19,20)21)12-26(23,24)17-9-5-14(2)6-10-17/h3-10,15H,11-12H2,1-2H3 |
| InChIKey | JCYXTOMTHAEMHK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene?
The IUPAC name of 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene (CID 67811281) is 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene.
What is the SMILES notation for 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene?
The canonical SMILES for 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene is Cc1ccc(S(=O)CC(CS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1.
What is the InChIKey of 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene?
The InChIKey is JCYXTOMTHAEMHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F3O3S2/c1-13-3-7-16(8-4-13)25(22)11-15(18(19,20)21)12-26(23,24)17-9-5-14(2)6-10-17/h3-10,15H,11-12H2,1-2H3.
What are the key properties of 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene?
1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene has a molecular weight of 404.48 g/mol, XLogP of 4.06, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[3,3,3-trifluoro-2-[(4-methylphenyl)sulfonylmethyl]propyl]sulfinylbenzene is sourced from PubChem (CID 67811281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).