C10H12Br2O2S — CID 15697980
1-(2,3-dibromopropylsulfonyl)-4-methylbenzene (PubChem CID 15697980) has the molecular formula C10H12Br2O2S and a molecular weight of 356.08 g/mol. Its IUPAC name is 1-(2,3-dibromopropylsulfonyl)-4-methylbenzene.
| Compound Name | 1-(2,3-dibromopropylsulfonyl)-4-methylbenzene |
|---|---|
| PubChem CID | 15697980 |
| Molecular Formula | C10H12Br2O2S |
| Molecular Weight | 356.08 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 1-(2,3-dibromopropylsulfonyl)-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CC(Br)CBr)cc1 |
| InChI | InChI=1S/C10H12Br2O2S/c1-8-2-4-10(5-3-8)15(13,14)7-9(12)6-11/h2-5,9H,6-7H2,1H3 |
| InChIKey | LGOIGJYVTYCHKC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.08 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|