C25H28O6S3 — CID 69003799
1-[3,4-bis-(4-methylphenyl)sulfonylbutylsulfonyl]-4-methylbenzene (PubChem CID 69003799) has the molecular formula C25H28O6S3 and a molecular weight of 520.69 g/mol. Its IUPAC name is 1-[3,4-bis-(4-methylphenyl)sulfonylbutylsulfonyl]-4-methylbenzene.
| Compound Name | 1-[3,4-bis-(4-methylphenyl)sulfonylbutylsulfonyl]-4-methylbenzene |
|---|---|
| PubChem CID | 69003799 |
| Molecular Formula | C25H28O6S3 |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 1-[3,4-bis-(4-methylphenyl)sulfonylbutylsulfonyl]-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CCC(CS(=O)(=O)c2ccc(C)cc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H28O6S3/c1-19-4-10-22(11-5-19)32(26,27)17-16-25(34(30,31)24-14-8-21(3)9-15-24)18-33(28,29)23-12-6-20(2)7-13-23/h4-15,25H,16-18H2,1-3H3 |
| InChIKey | RMZLLJSQMACFNS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |