C17H28O2S — CID 70500415
1-(3,7-dimethyloctylsulfonyl)-4-methylbenzene (PubChem CID 70500415) has the molecular formula C17H28O2S and a molecular weight of 296.48 g/mol. Its IUPAC name is 1-(3,7-dimethyloctylsulfonyl)-4-methylbenzene.
| Compound Name | 1-(3,7-dimethyloctylsulfonyl)-4-methylbenzene |
|---|---|
| PubChem CID | 70500415 |
| Molecular Formula | C17H28O2S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-(3,7-dimethyloctylsulfonyl)-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)CCC(C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C17H28O2S/c1-14(2)6-5-7-15(3)12-13-20(18,19)17-10-8-16(4)9-11-17/h8-11,14-15H,5-7,12-13H2,1-4H3 |
| InChIKey | UOODSICEPGHKRP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |