C27H46O4S — CID 57116779
[(3S)-3-[(2S,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxiran-2-yl] 4-methylbenzenesulfonate (PubChem CID 57116779) has the molecular formula C27H46O4S and a molecular weight of 466.73 g/mol. Its IUPAC name is [(3S)-3-[(2S,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxiran-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(3S)-3-[(2S,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxiran-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 57116779 |
| Molecular Formula | C27H46O4S |
| Molecular Weight | 466.73 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | [(3S)-3-[(2S,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxiran-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2O[C@H]2[C@@H](C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)cc1 |
| InChI | InChI=1S/C27H46O4S/c1-20(2)10-7-11-21(3)12-8-13-22(4)14-9-15-24(6)26-27(30-26)31-32(28,29)25-18-16-23(5)17-19-25/h16-22,24,26-27H,7-15H2,1-6H3/t21-,22-,24+,26+,27?/m1/s1 |
| InChIKey | IMFMQUBCCRGALC-YDTBXHROSA-N |
| XLogP | 7.50 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.73 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|