C19H22O6S2 — CID 19609073
2-methyl-3,4-bis-(4-methylphenyl)sulfonylbutanoic acid (PubChem CID 19609073) has the molecular formula C19H22O6S2 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-methyl-3,4-bis-(4-methylphenyl)sulfonylbutanoic acid.
| Compound Name | 2-methyl-3,4-bis-(4-methylphenyl)sulfonylbutanoic acid |
|---|---|
| PubChem CID | 19609073 |
| Molecular Formula | C19H22O6S2 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-methyl-3,4-bis-(4-methylphenyl)sulfonylbutanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)CC(C(C)C(=O)O)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H22O6S2/c1-13-4-8-16(9-5-13)26(22,23)12-18(15(3)19(20)21)27(24,25)17-10-6-14(2)7-11-17/h4-11,15,18H,12H2,1-3H3,(H,20,21) |
| InChIKey | GLTAMYCHEIYQKN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |