C22H23NO2S — CID 167596335
(1R,2S)-3-(4-methylphenyl)sulfonyl-1,2-diphenylpropan-1-amine (PubChem CID 167596335) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is (1R,2S)-3-(4-methylphenyl)sulfonyl-1,2-diphenylpropan-1-amine.
| Compound Name | (1R,2S)-3-(4-methylphenyl)sulfonyl-1,2-diphenylpropan-1-amine |
|---|---|
| PubChem CID | 167596335 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (1R,2S)-3-(4-methylphenyl)sulfonyl-1,2-diphenylpropan-1-amine |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](c2ccccc2)[C@@H](N)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO2S/c1-17-12-14-20(15-13-17)26(24,25)16-21(18-8-4-2-5-9-18)22(23)19-10-6-3-7-11-19/h2-15,21-22H,16,23H2,1H3/t21-,22-/m0/s1 |
| InChIKey | QCEGVPZGZUANDY-VXKWHMMOSA-N |
| XLogP | 4.25 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |