C17H21NO4S2 — CID 15423591
N-[3-(4-methylphenyl)sulfonyl-2-phenylpropyl]methanesulfonamide (PubChem CID 15423591) has the molecular formula C17H21NO4S2 and a molecular weight of 367.49 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)sulfonyl-2-phenylpropyl]methanesulfonamide.
| Compound Name | N-[3-(4-methylphenyl)sulfonyl-2-phenylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 15423591 |
| Molecular Formula | C17H21NO4S2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-[3-(4-methylphenyl)sulfonyl-2-phenylpropyl]methanesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)CC(CNS(C)(=O)=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H21NO4S2/c1-14-8-10-17(11-9-14)24(21,22)13-16(12-18-23(2,19)20)15-6-4-3-5-7-15/h3-11,16,18H,12-13H2,1-2H3 |
| InChIKey | IHTHOWRAGQGCFS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |