C20H25NO6S2 — CID 15423598
ethyl 4-[1-(methanesulfonamido)-3-(4-methylphenyl)sulfonylpropan-2-yl]benzoate (PubChem CID 15423598) has the molecular formula C20H25NO6S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is ethyl 4-[1-(methanesulfonamido)-3-(4-methylphenyl)sulfonylpropan-2-yl]benzoate.
| Compound Name | ethyl 4-[1-(methanesulfonamido)-3-(4-methylphenyl)sulfonylpropan-2-yl]benzoate |
|---|---|
| PubChem CID | 15423598 |
| Molecular Formula | C20H25NO6S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | ethyl 4-[1-(methanesulfonamido)-3-(4-methylphenyl)sulfonylpropan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(C(CNS(C)(=O)=O)CS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H25NO6S2/c1-4-27-20(22)17-9-7-16(8-10-17)18(13-21-28(3,23)24)14-29(25,26)19-11-5-15(2)6-12-19/h5-12,18,21H,4,13-14H2,1-3H3 |
| InChIKey | DQVKSDZNDJTUNR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |