C19H23NO4S — CID 58417597
N-hydroxy-4-[(2R)-1-(4-methylphenyl)sulfonylpentan-2-yl]benzamide (PubChem CID 58417597) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is N-hydroxy-4-[(2R)-1-(4-methylphenyl)sulfonylpentan-2-yl]benzamide.
| Compound Name | N-hydroxy-4-[(2R)-1-(4-methylphenyl)sulfonylpentan-2-yl]benzamide |
|---|---|
| PubChem CID | 58417597 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | N-hydroxy-4-[(2R)-1-(4-methylphenyl)sulfonylpentan-2-yl]benzamide |
| SMILES | CCC[C@@H](CS(=O)(=O)c1ccc(C)cc1)c1ccc(C(=O)NO)cc1 |
| InChI | InChI=1S/C19H23NO4S/c1-3-4-17(15-7-9-16(10-8-15)19(21)20-22)13-25(23,24)18-11-5-14(2)6-12-18/h5-12,17,22H,3-4,13H2,1-2H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | IOAIITYHMMILIH-KRWDZBQOSA-N |
| XLogP | 3.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|