C24H24N2O4S — CID 78888892
4-ethyl-N'-[4-[(4-methylphenyl)sulfonylmethyl]benzoyl]benzohydrazide (PubChem CID 78888892) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-ethyl-N'-[4-[(4-methylphenyl)sulfonylmethyl]benzoyl]benzohydrazide.
| Compound Name | 4-ethyl-N'-[4-[(4-methylphenyl)sulfonylmethyl]benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 78888892 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 4-ethyl-N'-[4-[(4-methylphenyl)sulfonylmethyl]benzoyl]benzohydrazide |
| SMILES | CCc1ccc(C(=O)NNC(=O)c2ccc(CS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-3-18-6-10-20(11-7-18)23(27)25-26-24(28)21-12-8-19(9-13-21)16-31(29,30)22-14-4-17(2)5-15-22/h4-15H,3,16H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | KIRTVHXLSFLRPR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|