C19H23N3O4S — CID 2093173
N,N-diethyl-4-[[(4-methylbenzoyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 2093173) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N,N-diethyl-4-[[(4-methylbenzoyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[(4-methylbenzoyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2093173 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N,N-diethyl-4-[[(4-methylbenzoyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)NNC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-4-22(5-2)27(25,26)17-12-10-16(11-13-17)19(24)21-20-18(23)15-8-6-14(3)7-9-15/h6-13H,4-5H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | SLTGFSPEFRDTHL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|