C17H20ClNO4S2 — CID 15423595
N-[2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonylpropyl]methanesulfonamide (PubChem CID 15423595) has the molecular formula C17H20ClNO4S2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonylpropyl]methanesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonylpropyl]methanesulfonamide |
|---|---|
| PubChem CID | 15423595 |
| Molecular Formula | C17H20ClNO4S2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-[2-(4-chlorophenyl)-3-(4-methylphenyl)sulfonylpropyl]methanesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)CC(CNS(C)(=O)=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H20ClNO4S2/c1-13-3-9-17(10-4-13)25(22,23)12-15(11-19-24(2,20)21)14-5-7-16(18)8-6-14/h3-10,15,19H,11-12H2,1-2H3 |
| InChIKey | STWBLCHDTHCZRV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |