C18H22ClNO2S2 — CID 51356515
N-[2-(4-chlorophenyl)-2-propylsulfanylethyl]-4-methylbenzenesulfonamide (PubChem CID 51356515) has the molecular formula C18H22ClNO2S2 and a molecular weight of 383.97 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-propylsulfanylethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)-2-propylsulfanylethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 51356515 |
| Molecular Formula | C18H22ClNO2S2 |
| Molecular Weight | 383.97 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-propylsulfanylethyl]-4-methylbenzenesulfonamide |
| SMILES | CCCSC(CNS(=O)(=O)c1ccc(C)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22ClNO2S2/c1-3-12-23-18(15-6-8-16(19)9-7-15)13-20-24(21,22)17-10-4-14(2)5-11-17/h4-11,18,20H,3,12-13H2,1-2H3 |
| InChIKey | JWHMQSFOWVRVEJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.97 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |