C19H22O2S — CID 158844988
1-methyl-4-(3-phenylhex-5-enylsulfonyl)benzene (PubChem CID 158844988) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-methyl-4-(3-phenylhex-5-enylsulfonyl)benzene.
| Compound Name | 1-methyl-4-(3-phenylhex-5-enylsulfonyl)benzene |
|---|---|
| PubChem CID | 158844988 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-methyl-4-(3-phenylhex-5-enylsulfonyl)benzene |
| SMILES | C=CCC(CCS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H22O2S/c1-3-7-17(18-8-5-4-6-9-18)14-15-22(20,21)19-12-10-16(2)11-13-19/h3-6,8-13,17H,1,7,14-15H2,2H3 |
| InChIKey | QDHAADGXNBLXAL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|