C27H30O6S3 — CID 11398689
1-[3-(benzenesulfonyl)-3-[2-(4-methylphenyl)sulfonylethyl]pent-4-enyl]sulfonyl-4-methylbenzene (PubChem CID 11398689) has the molecular formula C27H30O6S3 and a molecular weight of 546.73 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)-3-[2-(4-methylphenyl)sulfonylethyl]pent-4-enyl]sulfonyl-4-methylbenzene.
| Compound Name | 1-[3-(benzenesulfonyl)-3-[2-(4-methylphenyl)sulfonylethyl]pent-4-enyl]sulfonyl-4-methylbenzene |
|---|---|
| PubChem CID | 11398689 |
| Molecular Formula | C27H30O6S3 |
| Molecular Weight | 546.73 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | 1-[3-(benzenesulfonyl)-3-[2-(4-methylphenyl)sulfonylethyl]pent-4-enyl]sulfonyl-4-methylbenzene |
| SMILES | C=CC(CCS(=O)(=O)c1ccc(C)cc1)(CCS(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30O6S3/c1-4-27(36(32,33)26-8-6-5-7-9-26,18-20-34(28,29)24-14-10-22(2)11-15-24)19-21-35(30,31)25-16-12-23(3)13-17-25/h4-17H,1,18-21H2,2-3H3 |
| InChIKey | KZJHXYKUSNEKIQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.73 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|